C37H42N2O4 — CID 67520437
5-[(1R)-2-[2-[3-(2-adamantylmethoxy)phenyl]ethylamino]-1-hydroxyethyl]-8-phenylmethoxy-1H-quinolin-2-one (PubChem CID 67520437) has the molecular formula C37H42N2O4 and a molecular weight of 578.75 g/mol. Its IUPAC name is 5-[(1R)-2-[2-[3-(2-adamantylmethoxy)phenyl]ethylamino]-1-hydroxyethyl]-8-phenylmethoxy-1H-quinolin-2-one.
| Compound Name | 5-[(1R)-2-[2-[3-(2-adamantylmethoxy)phenyl]ethylamino]-1-hydroxyethyl]-8-phenylmethoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 67520437 |
| Molecular Formula | C37H42N2O4 |
| Molecular Weight | 578.75 g/mol |
| Exact Mass | 578.31 |
| IUPAC Name | 5-[(1R)-2-[2-[3-(2-adamantylmethoxy)phenyl]ethylamino]-1-hydroxyethyl]-8-phenylmethoxy-1H-quinolin-2-one |
| SMILES | O=c1ccc2c([C@@H](O)CNCCc3cccc(OCC4C5CC6CC(C5)CC4C6)c3)ccc(OCc3ccccc3)c2[nH]1 |
| InChI | InChI=1S/C37H42N2O4/c40-34(31-9-11-35(37-32(31)10-12-36(41)39-37)43-22-25-5-2-1-3-6-25)21-38-14-13-24-7-4-8-30(20-24)42-23-33-28-16-26-15-27(18-28)19-29(33)17-26/h1-12,20,26-29,33-34,38,40H,13-19,21-23H2,(H,39,41)/t26?,27?,28?,29?,33?,34-/m0/s1 |
| InChIKey | OLCHWJWHAPNWCP-FRQUWLIVSA-N |
| XLogP | 6.42 |
| TPSA | 83.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.75 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|