C32H38N2O5Si — CID 175041664
4-[[[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]methyl]benzoic acid (PubChem CID 175041664) has the molecular formula C32H38N2O5Si and a molecular weight of 558.75 g/mol. Its IUPAC name is 4-[[[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 175041664 |
| Molecular Formula | C32H38N2O5Si |
| Molecular Weight | 558.75 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | 4-[[[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]methyl]benzoic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CNCc1ccc(C(=O)O)cc1)c1ccc(OCc2ccccc2)c2[nH]c(=O)ccc12 |
| InChI | InChI=1S/C32H38N2O5Si/c1-32(2,3)40(4,5)39-28(20-33-19-22-11-13-24(14-12-22)31(36)37)25-15-17-27(30-26(25)16-18-29(35)34-30)38-21-23-9-7-6-8-10-23/h6-18,28,33H,19-21H2,1-5H3,(H,34,35)(H,36,37)/t28-/m0/s1 |
| InChIKey | IMRRASFGDGVGQH-NDEPHWFRSA-N |
| XLogP | 6.66 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.75 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|