C40H54N4O4Si — CID 87154233
N-[5-[(1R)-2-[2-[4-[4-(2-amino-2-methylpropoxy)anilino]phenyl]ethylamino]-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-phenylmethoxyphenyl]formamide (PubChem CID 87154233) has the molecular formula C40H54N4O4Si and a molecular weight of 682.98 g/mol. Its IUPAC name is N-[5-[(1R)-2-[2-[4-[4-(2-amino-2-methylpropoxy)anilino]phenyl]ethylamino]-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-phenylmethoxyphenyl]formamide.
| Compound Name | N-[5-[(1R)-2-[2-[4-[4-(2-amino-2-methylpropoxy)anilino]phenyl]ethylamino]-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-phenylmethoxyphenyl]formamide |
|---|---|
| PubChem CID | 87154233 |
| Molecular Formula | C40H54N4O4Si |
| Molecular Weight | 682.98 g/mol |
| Exact Mass | 682.39 |
| IUPAC Name | N-[5-[(1R)-2-[2-[4-[4-(2-amino-2-methylpropoxy)anilino]phenyl]ethylamino]-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-phenylmethoxyphenyl]formamide |
| SMILES | CC(C)(N)COc1ccc(Nc2ccc(CCNC[C@H](O[Si](C)(C)C(C)(C)C)c3ccc(OCc4ccccc4)c(NC=O)c3)cc2)cc1 |
| InChI | InChI=1S/C40H54N4O4Si/c1-39(2,3)49(6,7)48-38(32-15-22-37(36(25-32)43-29-45)46-27-31-11-9-8-10-12-31)26-42-24-23-30-13-16-33(17-14-30)44-34-18-20-35(21-19-34)47-28-40(4,5)41/h8-22,25,29,38,42,44H,23-24,26-28,41H2,1-7H3,(H,43,45)/t38-/m0/s1 |
| InChIKey | WXCASCNNPGTJBZ-LHEWISCISA-N |
| XLogP | 8.59 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.98 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|