C39H48F2N2O4Si — CID 90691266
N-[5-[1-[tert-butyl(dimethyl)silyl]oxy-2-[1-[4-(2,2-difluoro-2-phenylethoxy)phenyl]propan-2-ylamino]ethyl]-2-phenylmethoxyphenyl]formamide (PubChem CID 90691266) has the molecular formula C39H48F2N2O4Si and a molecular weight of 674.91 g/mol. Its IUPAC name is N-[5-[1-[tert-butyl(dimethyl)silyl]oxy-2-[1-[4-(2,2-difluoro-2-phenylethoxy)phenyl]propan-2-ylamino]ethyl]-2-phenylmethoxyphenyl]formamide.
| Compound Name | N-[5-[1-[tert-butyl(dimethyl)silyl]oxy-2-[1-[4-(2,2-difluoro-2-phenylethoxy)phenyl]propan-2-ylamino]ethyl]-2-phenylmethoxyphenyl]formamide |
|---|---|
| PubChem CID | 90691266 |
| Molecular Formula | C39H48F2N2O4Si |
| Molecular Weight | 674.91 g/mol |
| Exact Mass | 674.34 |
| IUPAC Name | N-[5-[1-[tert-butyl(dimethyl)silyl]oxy-2-[1-[4-(2,2-difluoro-2-phenylethoxy)phenyl]propan-2-ylamino]ethyl]-2-phenylmethoxyphenyl]formamide |
| SMILES | CC(Cc1ccc(OCC(F)(F)c2ccccc2)cc1)NCC(O[Si](C)(C)C(C)(C)C)c1ccc(OCc2ccccc2)c(NC=O)c1 |
| InChI | InChI=1S/C39H48F2N2O4Si/c1-29(23-30-17-20-34(21-18-30)46-27-39(40,41)33-15-11-8-12-16-33)42-25-37(47-48(5,6)38(2,3)4)32-19-22-36(35(24-32)43-28-44)45-26-31-13-9-7-10-14-31/h7-22,24,28-29,37,42H,23,25-27H2,1-6H3,(H,43,44) |
| InChIKey | SOBWQSHTGIMPQO-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.91 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|