C26H39NO5Si — CID 68837059
3-[3-[2-[[2-[tert-butyl(dimethyl)silyl]oxy-2-(3,5-dihydroxyphenyl)ethyl]amino]propyl]phenyl]propanoic acid (PubChem CID 68837059) has the molecular formula C26H39NO5Si and a molecular weight of 473.69 g/mol. Its IUPAC name is 3-[3-[2-[[2-[tert-butyl(dimethyl)silyl]oxy-2-(3,5-dihydroxyphenyl)ethyl]amino]propyl]phenyl]propanoic acid.
| Compound Name | 3-[3-[2-[[2-[tert-butyl(dimethyl)silyl]oxy-2-(3,5-dihydroxyphenyl)ethyl]amino]propyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 68837059 |
| Molecular Formula | C26H39NO5Si |
| Molecular Weight | 473.69 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | 3-[3-[2-[[2-[tert-butyl(dimethyl)silyl]oxy-2-(3,5-dihydroxyphenyl)ethyl]amino]propyl]phenyl]propanoic acid |
| SMILES | CC(Cc1cccc(CCC(=O)O)c1)NCC(O[Si](C)(C)C(C)(C)C)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C26H39NO5Si/c1-18(12-20-9-7-8-19(13-20)10-11-25(30)31)27-17-24(32-33(5,6)26(2,3)4)21-14-22(28)16-23(29)15-21/h7-9,13-16,18,24,27-29H,10-12,17H2,1-6H3,(H,30,31) |
| InChIKey | WSRDQLQCEZASFT-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.69 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|