C35H50N4O4Si — CID 58907512
2-[3-[(2R)-2-[[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(3-formamido-4-hydroxyphenyl)ethyl]amino]propyl]phenyl]-N-[[4-(dimethylamino)phenyl]methyl]acetamide (PubChem CID 58907512) has the molecular formula C35H50N4O4Si and a molecular weight of 618.90 g/mol. Its IUPAC name is 2-[3-[(2R)-2-[[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(3-formamido-4-hydroxyphenyl)ethyl]amino]propyl]phenyl]-N-[[4-(dimethylamino)phenyl]methyl]acetamide.
| Compound Name | 2-[3-[(2R)-2-[[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(3-formamido-4-hydroxyphenyl)ethyl]amino]propyl]phenyl]-N-[[4-(dimethylamino)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 58907512 |
| Molecular Formula | C35H50N4O4Si |
| Molecular Weight | 618.90 g/mol |
| Exact Mass | 618.36 |
| IUPAC Name | 2-[3-[(2R)-2-[[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(3-formamido-4-hydroxyphenyl)ethyl]amino]propyl]phenyl]-N-[[4-(dimethylamino)phenyl]methyl]acetamide |
| SMILES | C[C@H](Cc1cccc(CC(=O)NCc2ccc(N(C)C)cc2)c1)NC[C@H](O[Si](C)(C)C(C)(C)C)c1ccc(O)c(NC=O)c1 |
| InChI | InChI=1S/C35H50N4O4Si/c1-25(36-23-33(43-44(7,8)35(2,3)4)29-14-17-32(41)31(21-29)38-24-40)18-27-10-9-11-28(19-27)20-34(42)37-22-26-12-15-30(16-13-26)39(5)6/h9-17,19,21,24-25,33,36,41H,18,20,22-23H2,1-8H3,(H,37,42)(H,38,40)/t25-,33+/m1/s1 |
| InChIKey | CENJDSJKQJBNGO-HPMVVLTCSA-N |
| XLogP | 6.17 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.90 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|