C29H35N3O6S — CID 87547879
2-[3-[2-[[(2S)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]-2-methylpropyl]phenyl]-N-[(4-methylsulfonylphenyl)methyl]acetamide (PubChem CID 87547879) has the molecular formula C29H35N3O6S and a molecular weight of 553.68 g/mol. Its IUPAC name is 2-[3-[2-[[(2S)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]-2-methylpropyl]phenyl]-N-[(4-methylsulfonylphenyl)methyl]acetamide.
| Compound Name | 2-[3-[2-[[(2S)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]-2-methylpropyl]phenyl]-N-[(4-methylsulfonylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 87547879 |
| Molecular Formula | C29H35N3O6S |
| Molecular Weight | 553.68 g/mol |
| Exact Mass | 553.22 |
| IUPAC Name | 2-[3-[2-[[(2S)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]-2-methylpropyl]phenyl]-N-[(4-methylsulfonylphenyl)methyl]acetamide |
| SMILES | CC(C)(Cc1cccc(CC(=O)NCc2ccc(S(C)(=O)=O)cc2)c1)NC[C@@H](O)c1ccc(O)c(NC=O)c1 |
| InChI | InChI=1S/C29H35N3O6S/c1-29(2,32-18-27(35)23-9-12-26(34)25(15-23)31-19-33)16-22-6-4-5-21(13-22)14-28(36)30-17-20-7-10-24(11-8-20)39(3,37)38/h4-13,15,19,27,32,34-35H,14,16-18H2,1-3H3,(H,30,36)(H,31,33)/t27-/m1/s1 |
| InChIKey | HDPKMDHLVIFJPM-HHHXNRCGSA-N |
| XLogP | 2.87 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.68 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|