C29H35N3O5 — CID 87546845
3-[2-[[(2S)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]-2-methylpropyl]-N-[(4-hydroxy-3,5-dimethylphenyl)methyl]benzamide (PubChem CID 87546845) has the molecular formula C29H35N3O5 and a molecular weight of 505.62 g/mol. Its IUPAC name is 3-[2-[[(2S)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]-2-methylpropyl]-N-[(4-hydroxy-3,5-dimethylphenyl)methyl]benzamide.
| Compound Name | 3-[2-[[(2S)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]-2-methylpropyl]-N-[(4-hydroxy-3,5-dimethylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 87546845 |
| Molecular Formula | C29H35N3O5 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | 3-[2-[[(2S)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]-2-methylpropyl]-N-[(4-hydroxy-3,5-dimethylphenyl)methyl]benzamide |
| SMILES | Cc1cc(CNC(=O)c2cccc(CC(C)(C)NC[C@@H](O)c3ccc(O)c(NC=O)c3)c2)cc(C)c1O |
| InChI | InChI=1S/C29H35N3O5/c1-18-10-21(11-19(2)27(18)36)15-30-28(37)23-7-5-6-20(12-23)14-29(3,4)32-16-26(35)22-8-9-25(34)24(13-22)31-17-33/h5-13,17,26,32,34-36H,14-16H2,1-4H3,(H,30,37)(H,31,33)/t26-/m1/s1 |
| InChIKey | SRWQEBBAYNXOIN-AREMUKBSSA-N |
| XLogP | 3.86 |
| TPSA | 130.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|