C29H33N3O4 — CID 87547230
N-[5-[(1R)-2-[[1-[3-(3,4-dihydro-1H-isoquinoline-2-carbonyl)phenyl]-2-methylpropan-2-yl]amino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide (PubChem CID 87547230) has the molecular formula C29H33N3O4 and a molecular weight of 487.60 g/mol. Its IUPAC name is N-[5-[(1R)-2-[[1-[3-(3,4-dihydro-1H-isoquinoline-2-carbonyl)phenyl]-2-methylpropan-2-yl]amino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide.
| Compound Name | N-[5-[(1R)-2-[[1-[3-(3,4-dihydro-1H-isoquinoline-2-carbonyl)phenyl]-2-methylpropan-2-yl]amino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide |
|---|---|
| PubChem CID | 87547230 |
| Molecular Formula | C29H33N3O4 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | N-[5-[(1R)-2-[[1-[3-(3,4-dihydro-1H-isoquinoline-2-carbonyl)phenyl]-2-methylpropan-2-yl]amino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide |
| SMILES | CC(C)(Cc1cccc(C(=O)N2CCc3ccccc3C2)c1)NC[C@H](O)c1ccc(O)c(NC=O)c1 |
| InChI | InChI=1S/C29H33N3O4/c1-29(2,31-17-27(35)22-10-11-26(34)25(15-22)30-19-33)16-20-6-5-9-23(14-20)28(36)32-13-12-21-7-3-4-8-24(21)18-32/h3-11,14-15,19,27,31,34-35H,12-13,16-18H2,1-2H3,(H,30,33)/t27-/m0/s1 |
| InChIKey | HSVYVQOZMRCBMG-MHZLTWQESA-N |
| XLogP | 3.80 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|