C30H37N3O5 — CID 87547811
3-[2-[[(2S)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]-2-methylpropyl]-N-[2-(4-hydroxy-2,3-dimethylphenyl)ethyl]benzamide (PubChem CID 87547811) has the molecular formula C30H37N3O5 and a molecular weight of 519.64 g/mol. Its IUPAC name is 3-[2-[[(2S)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]-2-methylpropyl]-N-[2-(4-hydroxy-2,3-dimethylphenyl)ethyl]benzamide.
| Compound Name | 3-[2-[[(2S)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]-2-methylpropyl]-N-[2-(4-hydroxy-2,3-dimethylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 87547811 |
| Molecular Formula | C30H37N3O5 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | 3-[2-[[(2S)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]-2-methylpropyl]-N-[2-(4-hydroxy-2,3-dimethylphenyl)ethyl]benzamide |
| SMILES | Cc1c(O)ccc(CCNC(=O)c2cccc(CC(C)(C)NC[C@@H](O)c3ccc(O)c(NC=O)c3)c2)c1C |
| InChI | InChI=1S/C30H37N3O5/c1-19-20(2)26(35)10-8-22(19)12-13-31-29(38)24-7-5-6-21(14-24)16-30(3,4)33-17-28(37)23-9-11-27(36)25(15-23)32-18-34/h5-11,14-15,18,28,33,35-37H,12-13,16-17H2,1-4H3,(H,31,38)(H,32,34)/t28-/m1/s1 |
| InChIKey | QUPSDAZPIGGGGD-MUUNZHRXSA-N |
| XLogP | 3.90 |
| TPSA | 130.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|