C31H40N4O4 — CID 90963534
2-[3-[2-[[(2R)-2-[3-(carbamoylamino)-4-hydroxyphenyl]-2-hydroxyethyl]amino]-2-methylpropyl]phenyl]-N-(4-phenylbutyl)acetamide (PubChem CID 90963534) has the molecular formula C31H40N4O4 and a molecular weight of 532.69 g/mol. Its IUPAC name is 2-[3-[2-[[(2R)-2-[3-(carbamoylamino)-4-hydroxyphenyl]-2-hydroxyethyl]amino]-2-methylpropyl]phenyl]-N-(4-phenylbutyl)acetamide.
| Compound Name | 2-[3-[2-[[(2R)-2-[3-(carbamoylamino)-4-hydroxyphenyl]-2-hydroxyethyl]amino]-2-methylpropyl]phenyl]-N-(4-phenylbutyl)acetamide |
|---|---|
| PubChem CID | 90963534 |
| Molecular Formula | C31H40N4O4 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | 2-[3-[2-[[(2R)-2-[3-(carbamoylamino)-4-hydroxyphenyl]-2-hydroxyethyl]amino]-2-methylpropyl]phenyl]-N-(4-phenylbutyl)acetamide |
| SMILES | CC(C)(Cc1cccc(CC(=O)NCCCCc2ccccc2)c1)NC[C@H](O)c1ccc(O)c(NC(N)=O)c1 |
| InChI | InChI=1S/C31H40N4O4/c1-31(2,34-21-28(37)25-14-15-27(36)26(19-25)35-30(32)39)20-24-13-8-12-23(17-24)18-29(38)33-16-7-6-11-22-9-4-3-5-10-22/h3-5,8-10,12-15,17,19,28,34,36-37H,6-7,11,16,18,20-21H2,1-2H3,(H,33,38)(H3,32,35,39)/t28-/m0/s1 |
| InChIKey | WZXHPJMWLQYYEH-NDEPHWFRSA-N |
| XLogP | 4.21 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|