C25H36N4O5 — CID 91241694
2-[3-[2-[[(2R)-2-[3-(carbamoylamino)-4-hydroxyphenyl]-2-hydroxyethyl]amino]-2-methylpropyl]phenyl]-N-(3-methoxypropyl)acetamide (PubChem CID 91241694) has the molecular formula C25H36N4O5 and a molecular weight of 472.59 g/mol. Its IUPAC name is 2-[3-[2-[[(2R)-2-[3-(carbamoylamino)-4-hydroxyphenyl]-2-hydroxyethyl]amino]-2-methylpropyl]phenyl]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[3-[2-[[(2R)-2-[3-(carbamoylamino)-4-hydroxyphenyl]-2-hydroxyethyl]amino]-2-methylpropyl]phenyl]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 91241694 |
| Molecular Formula | C25H36N4O5 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | 2-[3-[2-[[(2R)-2-[3-(carbamoylamino)-4-hydroxyphenyl]-2-hydroxyethyl]amino]-2-methylpropyl]phenyl]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)Cc1cccc(CC(C)(C)NC[C@H](O)c2ccc(O)c(NC(N)=O)c2)c1 |
| InChI | InChI=1S/C25H36N4O5/c1-25(2,28-16-22(31)19-8-9-21(30)20(14-19)29-24(26)33)15-18-7-4-6-17(12-18)13-23(32)27-10-5-11-34-3/h4,6-9,12,14,22,28,30-31H,5,10-11,13,15-16H2,1-3H3,(H,27,32)(H3,26,29,33)/t22-/m0/s1 |
| InChIKey | IREXLQHHPCEJQA-QFIPXVFZSA-N |
| XLogP | 2.22 |
| TPSA | 145.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|