C25H36N2O5 — CID 68838640
2-[3-[2-[[2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]amino]-2-methylpropyl]phenyl]-N-(2-propoxyethyl)acetamide (PubChem CID 68838640) has the molecular formula C25H36N2O5 and a molecular weight of 444.57 g/mol. Its IUPAC name is 2-[3-[2-[[2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]amino]-2-methylpropyl]phenyl]-N-(2-propoxyethyl)acetamide.
| Compound Name | 2-[3-[2-[[2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]amino]-2-methylpropyl]phenyl]-N-(2-propoxyethyl)acetamide |
|---|---|
| PubChem CID | 68838640 |
| Molecular Formula | C25H36N2O5 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | 2-[3-[2-[[2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]amino]-2-methylpropyl]phenyl]-N-(2-propoxyethyl)acetamide |
| SMILES | CCCOCCNC(=O)Cc1cccc(CC(C)(C)NCC(O)c2cc(O)cc(O)c2)c1 |
| InChI | InChI=1S/C25H36N2O5/c1-4-9-32-10-8-26-24(31)12-18-6-5-7-19(11-18)16-25(2,3)27-17-23(30)20-13-21(28)15-22(29)14-20/h5-7,11,13-15,23,27-30H,4,8-10,12,16-17H2,1-3H3,(H,26,31) |
| InChIKey | UWHZLMQXQWDFAQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|