C27H39N3O5 — CID 68837397
2-[3-[2-[[2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]amino]-2-methylpropyl]phenyl]-N-(3-morpholin-4-ylpropyl)acetamide (PubChem CID 68837397) has the molecular formula C27H39N3O5 and a molecular weight of 485.63 g/mol. Its IUPAC name is 2-[3-[2-[[2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]amino]-2-methylpropyl]phenyl]-N-(3-morpholin-4-ylpropyl)acetamide.
| Compound Name | 2-[3-[2-[[2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]amino]-2-methylpropyl]phenyl]-N-(3-morpholin-4-ylpropyl)acetamide |
|---|---|
| PubChem CID | 68837397 |
| Molecular Formula | C27H39N3O5 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.29 |
| IUPAC Name | 2-[3-[2-[[2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]amino]-2-methylpropyl]phenyl]-N-(3-morpholin-4-ylpropyl)acetamide |
| SMILES | CC(C)(Cc1cccc(CC(=O)NCCCN2CCOCC2)c1)NCC(O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C27H39N3O5/c1-27(2,29-19-25(33)22-15-23(31)17-24(32)16-22)18-21-6-3-5-20(13-21)14-26(34)28-7-4-8-30-9-11-35-12-10-30/h3,5-6,13,15-17,25,29,31-33H,4,7-12,14,18-19H2,1-2H3,(H,28,34) |
| InChIKey | RUPXOZOSDOVBJQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|