C31H33N3O5 — CID 87548027
2-[3-[(2R)-2-[[(2S)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]propyl]phenyl]-N-[(2-hydroxynaphthalen-1-yl)methyl]acetamide (PubChem CID 87548027) has the molecular formula C31H33N3O5 and a molecular weight of 527.62 g/mol. Its IUPAC name is 2-[3-[(2R)-2-[[(2S)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]propyl]phenyl]-N-[(2-hydroxynaphthalen-1-yl)methyl]acetamide.
| Compound Name | 2-[3-[(2R)-2-[[(2S)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]propyl]phenyl]-N-[(2-hydroxynaphthalen-1-yl)methyl]acetamide |
|---|---|
| PubChem CID | 87548027 |
| Molecular Formula | C31H33N3O5 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | 2-[3-[(2R)-2-[[(2S)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]propyl]phenyl]-N-[(2-hydroxynaphthalen-1-yl)methyl]acetamide |
| SMILES | C[C@H](Cc1cccc(CC(=O)NCc2c(O)ccc3ccccc23)c1)NC[C@@H](O)c1ccc(O)c(NC=O)c1 |
| InChI | InChI=1S/C31H33N3O5/c1-20(32-18-30(38)24-10-12-29(37)27(16-24)34-19-35)13-21-5-4-6-22(14-21)15-31(39)33-17-26-25-8-3-2-7-23(25)9-11-28(26)36/h2-12,14,16,19-20,30,32,36-38H,13,15,17-18H2,1H3,(H,33,39)(H,34,35)/t20-,30-/m1/s1 |
| InChIKey | LXPZNYMPUBXKTB-PRAQEBQASA-N |
| XLogP | 3.93 |
| TPSA | 130.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|