C27H30F2N2O6 — CID 24880071
N-[5-[2-[1-[4-(2,2-difluoro-2-phenylethoxy)phenyl]propan-2-ylamino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide;formic acid (PubChem CID 24880071) has the molecular formula C27H30F2N2O6 and a molecular weight of 516.54 g/mol. Its IUPAC name is N-[5-[2-[1-[4-(2,2-difluoro-2-phenylethoxy)phenyl]propan-2-ylamino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide;formic acid.
| Compound Name | N-[5-[2-[1-[4-(2,2-difluoro-2-phenylethoxy)phenyl]propan-2-ylamino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide;formic acid |
|---|---|
| PubChem CID | 24880071 |
| Molecular Formula | C27H30F2N2O6 |
| Molecular Weight | 516.54 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | N-[5-[2-[1-[4-(2,2-difluoro-2-phenylethoxy)phenyl]propan-2-ylamino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide;formic acid |
| SMILES | CC(Cc1ccc(OCC(F)(F)c2ccccc2)cc1)NCC(O)c1ccc(O)c(NC=O)c1.O=CO |
| InChI | InChI=1S/C26H28F2N2O4.CH2O2/c1-18(29-15-25(33)20-9-12-24(32)23(14-20)30-17-31)13-19-7-10-22(11-8-19)34-16-26(27,28)21-5-3-2-4-6-21;2-1-3/h2-12,14,17-18,25,29,32-33H,13,15-16H2,1H3,(H,30,31);1H,(H,2,3) |
| InChIKey | RHZCSLPHRJGSBS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 128.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|