C23H30F2N2O4 — CID 88537953
N-[5-[2-[6-(2,2-difluoro-2-phenylethoxy)hexylamino]-2-hydroxyethyl]-2-hydroxyphenyl]formamide (PubChem CID 88537953) has the molecular formula C23H30F2N2O4 and a molecular weight of 436.50 g/mol. Its IUPAC name is N-[5-[2-[6-(2,2-difluoro-2-phenylethoxy)hexylamino]-2-hydroxyethyl]-2-hydroxyphenyl]formamide.
| Compound Name | N-[5-[2-[6-(2,2-difluoro-2-phenylethoxy)hexylamino]-2-hydroxyethyl]-2-hydroxyphenyl]formamide |
|---|---|
| PubChem CID | 88537953 |
| Molecular Formula | C23H30F2N2O4 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | N-[5-[2-[6-(2,2-difluoro-2-phenylethoxy)hexylamino]-2-hydroxyethyl]-2-hydroxyphenyl]formamide |
| SMILES | O=CNc1cc(CC(O)NCCCCCCOCC(F)(F)c2ccccc2)ccc1O |
| InChI | InChI=1S/C23H30F2N2O4/c24-23(25,19-8-4-3-5-9-19)16-31-13-7-2-1-6-12-26-22(30)15-18-10-11-21(29)20(14-18)27-17-28/h3-5,8-11,14,17,22,26,29-30H,1-2,6-7,12-13,15-16H2,(H,27,28) |
| InChIKey | DBTNGZRAGMUCNZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|