C24H33F2N3O5 — CID 140849960
[3-[2-[6-[[2-[4-(dihydroxymethyl)phenyl]-2-hydroxyethyl]amino]hexoxy]-1,1-difluoroethyl]phenyl]urea (PubChem CID 140849960) has the molecular formula C24H33F2N3O5 and a molecular weight of 481.54 g/mol. Its IUPAC name is [3-[2-[6-[[2-[4-(dihydroxymethyl)phenyl]-2-hydroxyethyl]amino]hexoxy]-1,1-difluoroethyl]phenyl]urea.
| Compound Name | [3-[2-[6-[[2-[4-(dihydroxymethyl)phenyl]-2-hydroxyethyl]amino]hexoxy]-1,1-difluoroethyl]phenyl]urea |
|---|---|
| PubChem CID | 140849960 |
| Molecular Formula | C24H33F2N3O5 |
| Molecular Weight | 481.54 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | [3-[2-[6-[[2-[4-(dihydroxymethyl)phenyl]-2-hydroxyethyl]amino]hexoxy]-1,1-difluoroethyl]phenyl]urea |
| SMILES | NC(=O)Nc1cccc(C(F)(F)COCCCCCCNCC(O)c2ccc(C(O)O)cc2)c1 |
| InChI | InChI=1S/C24H33F2N3O5/c25-24(26,19-6-5-7-20(14-19)29-23(27)33)16-34-13-4-2-1-3-12-28-15-21(30)17-8-10-18(11-9-17)22(31)32/h5-11,14,21-22,28,30-32H,1-4,12-13,15-16H2,(H3,27,29,33) |
| InChIKey | GAUWNMWQOQHMEP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.54 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|