C31H29N3O5 — CID 87777297
N-[5-[2-[2-[4-[3-(3-cyanophenyl)-4-methoxyphenoxy]phenyl]ethylamino]-2-hydroxyethyl]-2-hydroxyphenyl]formamide (PubChem CID 87777297) has the molecular formula C31H29N3O5 and a molecular weight of 523.59 g/mol. Its IUPAC name is N-[5-[2-[2-[4-[3-(3-cyanophenyl)-4-methoxyphenoxy]phenyl]ethylamino]-2-hydroxyethyl]-2-hydroxyphenyl]formamide.
| Compound Name | N-[5-[2-[2-[4-[3-(3-cyanophenyl)-4-methoxyphenoxy]phenyl]ethylamino]-2-hydroxyethyl]-2-hydroxyphenyl]formamide |
|---|---|
| PubChem CID | 87777297 |
| Molecular Formula | C31H29N3O5 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | N-[5-[2-[2-[4-[3-(3-cyanophenyl)-4-methoxyphenoxy]phenyl]ethylamino]-2-hydroxyethyl]-2-hydroxyphenyl]formamide |
| SMILES | COc1ccc(Oc2ccc(CCNC(O)Cc3ccc(O)c(NC=O)c3)cc2)cc1-c1cccc(C#N)c1 |
| InChI | InChI=1S/C31H29N3O5/c1-38-30-12-10-26(18-27(30)24-4-2-3-23(15-24)19-32)39-25-8-5-21(6-9-25)13-14-33-31(37)17-22-7-11-29(36)28(16-22)34-20-35/h2-12,15-16,18,20,31,33,36-37H,13-14,17H2,1H3,(H,34,35) |
| InChIKey | IMMQLGRLKCCZSU-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 123.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|