C24H33F2NO5 — CID 67976663
4-[2-[6-[2,2-difluoro-2-(3-methoxyphenyl)ethoxy]hexylamino]-2-hydroxyethyl]-2-(hydroxymethyl)phenol (PubChem CID 67976663) has the molecular formula C24H33F2NO5 and a molecular weight of 453.53 g/mol. Its IUPAC name is 4-[2-[6-[2,2-difluoro-2-(3-methoxyphenyl)ethoxy]hexylamino]-2-hydroxyethyl]-2-(hydroxymethyl)phenol.
| Compound Name | 4-[2-[6-[2,2-difluoro-2-(3-methoxyphenyl)ethoxy]hexylamino]-2-hydroxyethyl]-2-(hydroxymethyl)phenol |
|---|---|
| PubChem CID | 67976663 |
| Molecular Formula | C24H33F2NO5 |
| Molecular Weight | 453.53 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 4-[2-[6-[2,2-difluoro-2-(3-methoxyphenyl)ethoxy]hexylamino]-2-hydroxyethyl]-2-(hydroxymethyl)phenol |
| SMILES | COc1cccc(C(F)(F)COCCCCCCNC(O)Cc2ccc(O)c(CO)c2)c1 |
| InChI | InChI=1S/C24H33F2NO5/c1-31-21-8-6-7-20(15-21)24(25,26)17-32-12-5-3-2-4-11-27-23(30)14-18-9-10-22(29)19(13-18)16-28/h6-10,13,15,23,27-30H,2-5,11-12,14,16-17H2,1H3 |
| InChIKey | FNRJDPFVVFIMTC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 91.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|