C25H27F2NO4 — CID 24880210
4-[2-[2-[3-(2,2-difluoro-2-phenylethoxy)phenyl]ethylamino]-1-hydroxyethyl]-2-(hydroxymethyl)phenol (PubChem CID 24880210) has the molecular formula C25H27F2NO4 and a molecular weight of 443.49 g/mol. Its IUPAC name is 4-[2-[2-[3-(2,2-difluoro-2-phenylethoxy)phenyl]ethylamino]-1-hydroxyethyl]-2-(hydroxymethyl)phenol.
| Compound Name | 4-[2-[2-[3-(2,2-difluoro-2-phenylethoxy)phenyl]ethylamino]-1-hydroxyethyl]-2-(hydroxymethyl)phenol |
|---|---|
| PubChem CID | 24880210 |
| Molecular Formula | C25H27F2NO4 |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 4-[2-[2-[3-(2,2-difluoro-2-phenylethoxy)phenyl]ethylamino]-1-hydroxyethyl]-2-(hydroxymethyl)phenol |
| SMILES | OCc1cc(C(O)CNCCc2cccc(OCC(F)(F)c3ccccc3)c2)ccc1O |
| InChI | InChI=1S/C25H27F2NO4/c26-25(27,21-6-2-1-3-7-21)17-32-22-8-4-5-18(13-22)11-12-28-15-24(31)19-9-10-23(30)20(14-19)16-29/h1-10,13-14,24,28-31H,11-12,15-17H2 |
| InChIKey | UCSQGZIKNQYDBH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|