C42H58N2O4Si — CID 86649158
N-[5-[(1R)-2-[2-[4-[2-(1-adamantyl)ethoxy]phenyl]ethylamino]-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-phenylmethoxyphenyl]formamide (PubChem CID 86649158) has the molecular formula C42H58N2O4Si and a molecular weight of 683.02 g/mol. Its IUPAC name is N-[5-[(1R)-2-[2-[4-[2-(1-adamantyl)ethoxy]phenyl]ethylamino]-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-phenylmethoxyphenyl]formamide.
| Compound Name | N-[5-[(1R)-2-[2-[4-[2-(1-adamantyl)ethoxy]phenyl]ethylamino]-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-phenylmethoxyphenyl]formamide |
|---|---|
| PubChem CID | 86649158 |
| Molecular Formula | C42H58N2O4Si |
| Molecular Weight | 683.02 g/mol |
| Exact Mass | 682.42 |
| IUPAC Name | N-[5-[(1R)-2-[2-[4-[2-(1-adamantyl)ethoxy]phenyl]ethylamino]-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-phenylmethoxyphenyl]formamide |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CNCCc1ccc(OCCC23CC4CC(CC(C4)C2)C3)cc1)c1ccc(OCc2ccccc2)c(NC=O)c1 |
| InChI | InChI=1S/C42H58N2O4Si/c1-41(2,3)49(4,5)48-40(36-13-16-39(38(24-36)44-30-45)47-29-32-9-7-6-8-10-32)28-43-19-17-31-11-14-37(15-12-31)46-20-18-42-25-33-21-34(26-42)23-35(22-33)27-42/h6-16,24,30,33-35,40,43H,17-23,25-29H2,1-5H3,(H,44,45)/t33?,34?,35?,40-,42?/m0/s1 |
| InChIKey | JJSOEWCUXVMOMY-FZBHMHMDSA-N |
| XLogP | 9.71 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.02 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|