C34H47NO5Si — CID 69025815
2-[3-[2-[[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[3-(hydroxymethyl)-4-phenylmethoxyphenyl]ethyl]amino]ethyl]phenyl]butanoic acid (PubChem CID 69025815) has the molecular formula C34H47NO5Si and a molecular weight of 577.84 g/mol. Its IUPAC name is 2-[3-[2-[[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[3-(hydroxymethyl)-4-phenylmethoxyphenyl]ethyl]amino]ethyl]phenyl]butanoic acid.
| Compound Name | 2-[3-[2-[[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[3-(hydroxymethyl)-4-phenylmethoxyphenyl]ethyl]amino]ethyl]phenyl]butanoic acid |
|---|---|
| PubChem CID | 69025815 |
| Molecular Formula | C34H47NO5Si |
| Molecular Weight | 577.84 g/mol |
| Exact Mass | 577.32 |
| IUPAC Name | 2-[3-[2-[[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[3-(hydroxymethyl)-4-phenylmethoxyphenyl]ethyl]amino]ethyl]phenyl]butanoic acid |
| SMILES | CCC(C(=O)O)c1cccc(CCNC[C@H](O[Si](C)(C)C(C)(C)C)c2ccc(OCc3ccccc3)c(CO)c2)c1 |
| InChI | InChI=1S/C34H47NO5Si/c1-7-30(33(37)38)27-15-11-14-25(20-27)18-19-35-22-32(40-41(5,6)34(2,3)4)28-16-17-31(29(21-28)23-36)39-24-26-12-9-8-10-13-26/h8-17,20-21,30,32,35-36H,7,18-19,22-24H2,1-6H3,(H,37,38)/t30?,32-/m0/s1 |
| InChIKey | MFHDYSCQCZZAND-AUPVMFHISA-N |
| XLogP | 7.23 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.84 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|