C42H53NO5Si — CID 69024828
benzyl 3-[3-[2-[[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[3-(hydroxymethyl)-4-phenylmethoxyphenyl]ethyl]amino]-2-methylpropyl]phenyl]prop-2-enoate (PubChem CID 69024828) has the molecular formula C42H53NO5Si and a molecular weight of 679.97 g/mol. Its IUPAC name is benzyl 3-[3-[2-[[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[3-(hydroxymethyl)-4-phenylmethoxyphenyl]ethyl]amino]-2-methylpropyl]phenyl]prop-2-enoate.
| Compound Name | benzyl 3-[3-[2-[[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[3-(hydroxymethyl)-4-phenylmethoxyphenyl]ethyl]amino]-2-methylpropyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 69024828 |
| Molecular Formula | C42H53NO5Si |
| Molecular Weight | 679.97 g/mol |
| Exact Mass | 679.37 |
| IUPAC Name | benzyl 3-[3-[2-[[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[3-(hydroxymethyl)-4-phenylmethoxyphenyl]ethyl]amino]-2-methylpropyl]phenyl]prop-2-enoate |
| SMILES | CC(C)(Cc1cccc(C=CC(=O)OCc2ccccc2)c1)NC[C@H](O[Si](C)(C)C(C)(C)C)c1ccc(OCc2ccccc2)c(CO)c1 |
| InChI | InChI=1S/C42H53NO5Si/c1-41(2,3)49(6,7)48-39(36-22-23-38(37(26-36)29-44)46-30-33-15-10-8-11-16-33)28-43-42(4,5)27-35-20-14-19-32(25-35)21-24-40(45)47-31-34-17-12-9-13-18-34/h8-26,39,43-44H,27-31H2,1-7H3/t39-/m0/s1 |
| InChIKey | KFHZULLVZQBXBS-KDXMTYKHSA-N |
| XLogP | 9.19 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.97 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|