C28H43NO5Si — CID 91268614
[3-[2-[[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]-2-methylpropyl]phenyl] propanoate (PubChem CID 91268614) has the molecular formula C28H43NO5Si and a molecular weight of 501.74 g/mol. Its IUPAC name is [3-[2-[[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]-2-methylpropyl]phenyl] propanoate.
| Compound Name | [3-[2-[[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]-2-methylpropyl]phenyl] propanoate |
|---|---|
| PubChem CID | 91268614 |
| Molecular Formula | C28H43NO5Si |
| Molecular Weight | 501.74 g/mol |
| Exact Mass | 501.29 |
| IUPAC Name | [3-[2-[[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]-2-methylpropyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1cccc(CC(C)(C)NC[C@H](O[Si](C)(C)C(C)(C)C)c2ccc(O)c(CO)c2)c1 |
| InChI | InChI=1S/C28H43NO5Si/c1-9-26(32)33-23-12-10-11-20(15-23)17-28(5,6)29-18-25(34-35(7,8)27(2,3)4)21-13-14-24(31)22(16-21)19-30/h10-16,25,29-31H,9,17-19H2,1-8H3/t25-/m0/s1 |
| InChIKey | ZTGOGSIZTVFOHV-VWLOTQADSA-N |
| XLogP | 5.87 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.74 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|