C36H44N2O4 — CID 90780049
N-[5-[2-[2-[4-[2-(1-adamantyl)ethoxy]phenyl]ethylamino]-1-hydroxyethyl]-2-phenylmethoxyphenyl]formamide (PubChem CID 90780049) has the molecular formula C36H44N2O4 and a molecular weight of 568.76 g/mol. Its IUPAC name is N-[5-[2-[2-[4-[2-(1-adamantyl)ethoxy]phenyl]ethylamino]-1-hydroxyethyl]-2-phenylmethoxyphenyl]formamide.
| Compound Name | N-[5-[2-[2-[4-[2-(1-adamantyl)ethoxy]phenyl]ethylamino]-1-hydroxyethyl]-2-phenylmethoxyphenyl]formamide |
|---|---|
| PubChem CID | 90780049 |
| Molecular Formula | C36H44N2O4 |
| Molecular Weight | 568.76 g/mol |
| Exact Mass | 568.33 |
| IUPAC Name | N-[5-[2-[2-[4-[2-(1-adamantyl)ethoxy]phenyl]ethylamino]-1-hydroxyethyl]-2-phenylmethoxyphenyl]formamide |
| SMILES | O=CNc1cc(C(O)CNCCc2ccc(OCCC34CC5CC(CC(C5)C3)C4)cc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C36H44N2O4/c39-25-38-33-19-31(8-11-35(33)42-24-27-4-2-1-3-5-27)34(40)23-37-14-12-26-6-9-32(10-7-26)41-15-13-36-20-28-16-29(21-36)18-30(17-28)22-36/h1-11,19,25,28-30,34,37,40H,12-18,20-24H2,(H,38,39) |
| InChIKey | NAGSPSANZGJFRF-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.76 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|