C29H37N3O4 — CID 89129743
N-[2-butoxy-5-[(1R)-2-[2-[4-(4-ethoxyanilino)phenyl]ethylamino]-1-hydroxyethyl]phenyl]formamide (PubChem CID 89129743) has the molecular formula C29H37N3O4 and a molecular weight of 491.63 g/mol. Its IUPAC name is N-[2-butoxy-5-[(1R)-2-[2-[4-(4-ethoxyanilino)phenyl]ethylamino]-1-hydroxyethyl]phenyl]formamide.
| Compound Name | N-[2-butoxy-5-[(1R)-2-[2-[4-(4-ethoxyanilino)phenyl]ethylamino]-1-hydroxyethyl]phenyl]formamide |
|---|---|
| PubChem CID | 89129743 |
| Molecular Formula | C29H37N3O4 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | N-[2-butoxy-5-[(1R)-2-[2-[4-(4-ethoxyanilino)phenyl]ethylamino]-1-hydroxyethyl]phenyl]formamide |
| SMILES | CCCCOc1ccc([C@@H](O)CNCCc2ccc(Nc3ccc(OCC)cc3)cc2)cc1NC=O |
| InChI | InChI=1S/C29H37N3O4/c1-3-5-18-36-29-15-8-23(19-27(29)31-21-33)28(34)20-30-17-16-22-6-9-24(10-7-22)32-25-11-13-26(14-12-25)35-4-2/h6-15,19,21,28,30,32,34H,3-5,16-18,20H2,1-2H3,(H,31,33)/t28-/m0/s1 |
| InChIKey | FVNMRJGIGSHAJN-NDEPHWFRSA-N |
| XLogP | 5.44 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|