C36H42N2O5 — CID 70951476
methyl 2-butoxy-5-[(1R)-2-[2-[4-(4-ethoxy-3-phenylanilino)phenyl]ethylamino]-1-hydroxyethyl]benzoate (PubChem CID 70951476) has the molecular formula C36H42N2O5 and a molecular weight of 582.74 g/mol. Its IUPAC name is methyl 2-butoxy-5-[(1R)-2-[2-[4-(4-ethoxy-3-phenylanilino)phenyl]ethylamino]-1-hydroxyethyl]benzoate.
| Compound Name | methyl 2-butoxy-5-[(1R)-2-[2-[4-(4-ethoxy-3-phenylanilino)phenyl]ethylamino]-1-hydroxyethyl]benzoate |
|---|---|
| PubChem CID | 70951476 |
| Molecular Formula | C36H42N2O5 |
| Molecular Weight | 582.74 g/mol |
| Exact Mass | 582.31 |
| IUPAC Name | methyl 2-butoxy-5-[(1R)-2-[2-[4-(4-ethoxy-3-phenylanilino)phenyl]ethylamino]-1-hydroxyethyl]benzoate |
| SMILES | CCCCOc1ccc([C@@H](O)CNCCc2ccc(Nc3ccc(OCC)c(-c4ccccc4)c3)cc2)cc1C(=O)OC |
| InChI | InChI=1S/C36H42N2O5/c1-4-6-22-43-35-18-14-28(23-32(35)36(40)41-3)33(39)25-37-21-20-26-12-15-29(16-13-26)38-30-17-19-34(42-5-2)31(24-30)27-10-8-7-9-11-27/h7-19,23-24,33,37-39H,4-6,20-22,25H2,1-3H3/t33-/m0/s1 |
| InChIKey | DPSVYPMLEIJVGD-XIFFEERXSA-N |
| XLogP | 7.33 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.74 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|