C33H39NO — CID 159982898
(1S)-1-(3,4-dimethylphenyl)-5-[4-(4-methyl-3-phenylanilino)phenyl]pentan-1-ol;methane (PubChem CID 159982898) has the molecular formula C33H39NO and a molecular weight of 465.68 g/mol. Its IUPAC name is (1S)-1-(3,4-dimethylphenyl)-5-[4-(4-methyl-3-phenylanilino)phenyl]pentan-1-ol;methane.
| Compound Name | (1S)-1-(3,4-dimethylphenyl)-5-[4-(4-methyl-3-phenylanilino)phenyl]pentan-1-ol;methane |
|---|---|
| PubChem CID | 159982898 |
| Molecular Formula | C33H39NO |
| Molecular Weight | 465.68 g/mol |
| Exact Mass | 465.30 |
| IUPAC Name | (1S)-1-(3,4-dimethylphenyl)-5-[4-(4-methyl-3-phenylanilino)phenyl]pentan-1-ol;methane |
| SMILES | C.Cc1ccc([C@@H](O)CCCCc2ccc(Nc3ccc(C)c(-c4ccccc4)c3)cc2)cc1C |
| InChI | InChI=1S/C32H35NO.CH4/c1-23-13-17-28(21-25(23)3)32(34)12-8-7-9-26-15-19-29(20-16-26)33-30-18-14-24(2)31(22-30)27-10-5-4-6-11-27;/h4-6,10-11,13-22,32-34H,7-9,12H2,1-3H3;1H4/t32-;/m0./s1 |
| InChIKey | OFZOVBYAHXUQAR-UCRKPPETSA-N |
| XLogP | 9.10 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.68 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|