C32H34N2O2 — CID 59119416
[5-[(1S)-1-hydroxy-5-[4-(4-methyl-3-phenylanilino)phenyl]pentyl]-2-methylphenyl] methanimidate (PubChem CID 59119416) has the molecular formula C32H34N2O2 and a molecular weight of 478.64 g/mol. Its IUPAC name is [5-[(1S)-1-hydroxy-5-[4-(4-methyl-3-phenylanilino)phenyl]pentyl]-2-methylphenyl] methanimidate.
| Compound Name | [5-[(1S)-1-hydroxy-5-[4-(4-methyl-3-phenylanilino)phenyl]pentyl]-2-methylphenyl] methanimidate |
|---|---|
| PubChem CID | 59119416 |
| Molecular Formula | C32H34N2O2 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | [5-[(1S)-1-hydroxy-5-[4-(4-methyl-3-phenylanilino)phenyl]pentyl]-2-methylphenyl] methanimidate |
| SMILES | [H]/N=C/Oc1cc([C@@H](O)CCCCc2ccc(Nc3ccc(C)c(-c4ccccc4)c3)cc2)ccc1C |
| InChI | InChI=1S/C32H34N2O2/c1-23-13-17-29(21-30(23)26-9-4-3-5-10-26)34-28-18-14-25(15-19-28)8-6-7-11-31(35)27-16-12-24(2)32(20-27)36-22-33/h3-5,9-10,12-22,31,33-35H,6-8,11H2,1-2H3/b33-22+/t31-/m0/s1 |
| InChIKey | NBXHQQUGAVPUGU-DSWPHNCVSA-N |
| XLogP | 8.15 |
| TPSA | 65.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|