C32H34N2O2 — CID 20605115
N-[5-[1-hydroxy-5-[4-(4-methyl-3-phenylanilino)phenyl]pentyl]-2-methylphenyl]formamide (PubChem CID 20605115) has the molecular formula C32H34N2O2 and a molecular weight of 478.64 g/mol. Its IUPAC name is N-[5-[1-hydroxy-5-[4-(4-methyl-3-phenylanilino)phenyl]pentyl]-2-methylphenyl]formamide.
| Compound Name | N-[5-[1-hydroxy-5-[4-(4-methyl-3-phenylanilino)phenyl]pentyl]-2-methylphenyl]formamide |
|---|---|
| PubChem CID | 20605115 |
| Molecular Formula | C32H34N2O2 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | N-[5-[1-hydroxy-5-[4-(4-methyl-3-phenylanilino)phenyl]pentyl]-2-methylphenyl]formamide |
| SMILES | Cc1ccc(C(O)CCCCc2ccc(Nc3ccc(C)c(-c4ccccc4)c3)cc2)cc1NC=O |
| InChI | InChI=1S/C32H34N2O2/c1-23-13-17-29(21-30(23)26-9-4-3-5-10-26)34-28-18-14-25(15-19-28)8-6-7-11-32(36)27-16-12-24(2)31(20-27)33-22-35/h3-5,9-10,12-22,32,34,36H,6-8,11H2,1-2H3,(H,33,35) |
| InChIKey | PVFZKGSMVGUCJT-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|