C30H32N4O4S — CID 59119471
N-[5-[(1S)-1-hydroxy-5-[4-[4-(pyridin-2-ylsulfamoyl)anilino]phenyl]pentyl]-2-methylphenyl]formamide (PubChem CID 59119471) has the molecular formula C30H32N4O4S and a molecular weight of 544.68 g/mol. Its IUPAC name is N-[5-[(1S)-1-hydroxy-5-[4-[4-(pyridin-2-ylsulfamoyl)anilino]phenyl]pentyl]-2-methylphenyl]formamide.
| Compound Name | N-[5-[(1S)-1-hydroxy-5-[4-[4-(pyridin-2-ylsulfamoyl)anilino]phenyl]pentyl]-2-methylphenyl]formamide |
|---|---|
| PubChem CID | 59119471 |
| Molecular Formula | C30H32N4O4S |
| Molecular Weight | 544.68 g/mol |
| Exact Mass | 544.21 |
| IUPAC Name | N-[5-[(1S)-1-hydroxy-5-[4-[4-(pyridin-2-ylsulfamoyl)anilino]phenyl]pentyl]-2-methylphenyl]formamide |
| SMILES | Cc1ccc([C@@H](O)CCCCc2ccc(Nc3ccc(S(=O)(=O)Nc4ccccn4)cc3)cc2)cc1NC=O |
| InChI | InChI=1S/C30H32N4O4S/c1-22-9-12-24(20-28(22)32-21-35)29(36)7-3-2-6-23-10-13-25(14-11-23)33-26-15-17-27(18-16-26)39(37,38)34-30-8-4-5-19-31-30/h4-5,8-21,29,33,36H,2-3,6-7H2,1H3,(H,31,34)(H,32,35)/t29-/m0/s1 |
| InChIKey | LFMWQSSXTOWKGW-LJAQVGFWSA-N |
| XLogP | 5.95 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.68 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|