C24H33N3O6S — CID 166070312
diethyl 2-[1-[4-(pyridin-2-ylsulfamoyl)anilino]hexyl]propanedioate (PubChem CID 166070312) has the molecular formula C24H33N3O6S and a molecular weight of 491.61 g/mol. Its IUPAC name is diethyl 2-[1-[4-(pyridin-2-ylsulfamoyl)anilino]hexyl]propanedioate.
| Compound Name | diethyl 2-[1-[4-(pyridin-2-ylsulfamoyl)anilino]hexyl]propanedioate |
|---|---|
| PubChem CID | 166070312 |
| Molecular Formula | C24H33N3O6S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | diethyl 2-[1-[4-(pyridin-2-ylsulfamoyl)anilino]hexyl]propanedioate |
| SMILES | CCCCCC(Nc1ccc(S(=O)(=O)Nc2ccccn2)cc1)C(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C24H33N3O6S/c1-4-7-8-11-20(22(23(28)32-5-2)24(29)33-6-3)26-18-13-15-19(16-14-18)34(30,31)27-21-12-9-10-17-25-21/h9-10,12-17,20,22,26H,4-8,11H2,1-3H3,(H,25,27) |
| InChIKey | RVKMDWZRGIFJSD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|