C29H36N4O5S — CID 144798775
[2-acetyl-4-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]phenyl] octanoate;ethane (PubChem CID 144798775) has the molecular formula C29H36N4O5S and a molecular weight of 552.70 g/mol. Its IUPAC name is [2-acetyl-4-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]phenyl] octanoate;ethane.
| Compound Name | [2-acetyl-4-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]phenyl] octanoate;ethane |
|---|---|
| PubChem CID | 144798775 |
| Molecular Formula | C29H36N4O5S |
| Molecular Weight | 552.70 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | [2-acetyl-4-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]phenyl] octanoate;ethane |
| SMILES | CC.CCCCCCCC(=O)Oc1ccc(/N=N/c2ccc(S(=O)(=O)Nc3ccccn3)cc2)cc1C(C)=O |
| InChI | InChI=1S/C27H30N4O5S.C2H6/c1-3-4-5-6-7-11-27(33)36-25-17-14-22(19-24(25)20(2)32)30-29-21-12-15-23(16-13-21)37(34,35)31-26-10-8-9-18-28-26;1-2/h8-10,12-19H,3-7,11H2,1-2H3,(H,28,31);1-2H3/b30-29+; |
| InChIKey | TYRANBCLJSKSKT-BXGDTPBJSA-N |
| XLogP | 7.79 |
| TPSA | 127.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.70 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|