C40H48N4O5S2 — CID 144798807
[2-acetyl-4-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]phenyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate;methanethiol (PubChem CID 144798807) has the molecular formula C40H48N4O5S2 and a molecular weight of 728.98 g/mol. Its IUPAC name is [2-acetyl-4-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]phenyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate;methanethiol.
| Compound Name | [2-acetyl-4-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]phenyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate;methanethiol |
|---|---|
| PubChem CID | 144798807 |
| Molecular Formula | C40H48N4O5S2 |
| Molecular Weight | 728.98 g/mol |
| Exact Mass | 728.31 |
| IUPAC Name | [2-acetyl-4-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]phenyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate;methanethiol |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)Oc1ccc(/N=N/c2ccc(S(=O)(=O)Nc3ccccn3)cc2)cc1C(C)=O.CS |
| InChI | InChI=1S/C39H44N4O5S.CH4S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23-39(45)48-37-29-26-34(31-36(37)32(2)44)42-41-33-24-27-35(28-25-33)49(46,47)43-38-22-20-21-30-40-38;1-2/h4-5,7-8,10-11,13-14,16-17,20-22,24-31H,3,6,9,12,15,18-19,23H2,1-2H3,(H,40,43);2H,1H3/b5-4-,8-7-,11-10-,14-13-,17-16-,42-41+; |
| InChIKey | BDMACVUPQOQKOF-UJSUACJLSA-N |
| XLogP | 10.87 |
| TPSA | 127.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.98 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|