C28H33N5O6S — CID 150955882
3-[2-(dibutylamino)-2-oxoethyl]-2-hydroxy-5-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]benzoic acid (PubChem CID 150955882) has the molecular formula C28H33N5O6S and a molecular weight of 567.67 g/mol. Its IUPAC name is 3-[2-(dibutylamino)-2-oxoethyl]-2-hydroxy-5-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]benzoic acid.
| Compound Name | 3-[2-(dibutylamino)-2-oxoethyl]-2-hydroxy-5-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 150955882 |
| Molecular Formula | C28H33N5O6S |
| Molecular Weight | 567.67 g/mol |
| Exact Mass | 567.22 |
| IUPAC Name | 3-[2-(dibutylamino)-2-oxoethyl]-2-hydroxy-5-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]benzoic acid |
| SMILES | CCCCN(CCCC)C(=O)Cc1cc(/N=N/c2ccc(S(=O)(=O)Nc3ccccn3)cc2)cc(C(=O)O)c1O |
| InChI | InChI=1S/C28H33N5O6S/c1-3-5-15-33(16-6-4-2)26(34)18-20-17-22(19-24(27(20)35)28(36)37)31-30-21-10-12-23(13-11-21)40(38,39)32-25-9-7-8-14-29-25/h7-14,17,19,35H,3-6,15-16,18H2,1-2H3,(H,29,32)(H,36,37)/b31-30+ |
| InChIKey | LLBQVVGURQVNSB-NVQSTNCTSA-N |
| XLogP | 5.67 |
| TPSA | 161.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.67 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|