C24H24N6O6S — CID 154966021
(2-oxo-2-piperazin-1-ylethyl) 2-hydroxy-5-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]benzoate (PubChem CID 154966021) has the molecular formula C24H24N6O6S and a molecular weight of 524.56 g/mol. Its IUPAC name is (2-oxo-2-piperazin-1-ylethyl) 2-hydroxy-5-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]benzoate.
| Compound Name | (2-oxo-2-piperazin-1-ylethyl) 2-hydroxy-5-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]benzoate |
|---|---|
| PubChem CID | 154966021 |
| Molecular Formula | C24H24N6O6S |
| Molecular Weight | 524.56 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | (2-oxo-2-piperazin-1-ylethyl) 2-hydroxy-5-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]benzoate |
| SMILES | O=C(OCC(=O)N1CCNCC1)c1cc(/N=N/c2ccc(S(=O)(=O)Nc3ccccn3)cc2)ccc1O |
| InChI | InChI=1S/C24H24N6O6S/c31-21-9-6-18(15-20(21)24(33)36-16-23(32)30-13-11-25-12-14-30)28-27-17-4-7-19(8-5-17)37(34,35)29-22-3-1-2-10-26-22/h1-10,15,25,31H,11-14,16H2,(H,26,29)/b28-27+ |
| InChIKey | HKVLBTMKBHCKBI-BYYHNAKLSA-N |
| XLogP | 2.59 |
| TPSA | 162.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.56 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|