C20H27N3O7S — CID 166524042
dimethyl 2-[(1R)-1-[4-(1,3-oxazol-2-ylsulfamoyl)anilino]hexyl]propanedioate (PubChem CID 166524042) has the molecular formula C20H27N3O7S and a molecular weight of 453.52 g/mol. Its IUPAC name is dimethyl 2-[(1R)-1-[4-(1,3-oxazol-2-ylsulfamoyl)anilino]hexyl]propanedioate.
| Compound Name | dimethyl 2-[(1R)-1-[4-(1,3-oxazol-2-ylsulfamoyl)anilino]hexyl]propanedioate |
|---|---|
| PubChem CID | 166524042 |
| Molecular Formula | C20H27N3O7S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | dimethyl 2-[(1R)-1-[4-(1,3-oxazol-2-ylsulfamoyl)anilino]hexyl]propanedioate |
| SMILES | CCCCC[C@@H](Nc1ccc(S(=O)(=O)Nc2ncco2)cc1)C(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C20H27N3O7S/c1-4-5-6-7-16(17(18(24)28-2)19(25)29-3)22-14-8-10-15(11-9-14)31(26,27)23-20-21-12-13-30-20/h8-13,16-17,22H,4-7H2,1-3H3,(H,21,23)/t16-/m1/s1 |
| InChIKey | ABVUNKMSPQRTIX-MRXNPFEDSA-N |
| XLogP | 2.80 |
| TPSA | 136.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|