C22H25N3O8S — CID 167437404
diethyl 2-[(S)-furan-2-yl-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]anilino]methyl]propanedioate (PubChem CID 167437404) has the molecular formula C22H25N3O8S and a molecular weight of 491.52 g/mol. Its IUPAC name is diethyl 2-[(S)-furan-2-yl-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]anilino]methyl]propanedioate.
| Compound Name | diethyl 2-[(S)-furan-2-yl-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]anilino]methyl]propanedioate |
|---|---|
| PubChem CID | 167437404 |
| Molecular Formula | C22H25N3O8S |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | diethyl 2-[(S)-furan-2-yl-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]anilino]methyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@H](Nc1ccc(S(=O)(=O)Nc2cc(C)on2)cc1)c1ccco1 |
| InChI | InChI=1S/C22H25N3O8S/c1-4-30-21(26)19(22(27)31-5-2)20(17-7-6-12-32-17)23-15-8-10-16(11-9-15)34(28,29)25-18-13-14(3)33-24-18/h6-13,19-20,23H,4-5H2,1-3H3,(H,24,25)/t20-/m1/s1 |
| InChIKey | ONBQLKSLDKDABF-HXUWFJFHSA-N |
| XLogP | 3.27 |
| TPSA | 149.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|