C18H16N4O5S2 — CID 3097481
3-(furan-2-yl)-N-[[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]carbamothioyl]prop-2-enamide (PubChem CID 3097481) has the molecular formula C18H16N4O5S2 and a molecular weight of 432.48 g/mol. Its IUPAC name is 3-(furan-2-yl)-N-[[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | 3-(furan-2-yl)-N-[[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 3097481 |
| Molecular Formula | C18H16N4O5S2 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | 3-(furan-2-yl)-N-[[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]carbamothioyl]prop-2-enamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)C=Cc3ccco3)cc2)no1 |
| InChI | InChI=1S/C18H16N4O5S2/c1-12-11-16(21-27-12)22-29(24,25)15-7-4-13(5-8-15)19-18(28)20-17(23)9-6-14-3-2-10-26-14/h2-11H,1H3,(H,21,22)(H2,19,20,23,28) |
| InChIKey | LSRRKNHVSTXMMN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 126.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|