C13H16N4O3S2 — CID 2730614
1-ethyl-3-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]thiourea (PubChem CID 2730614) has the molecular formula C13H16N4O3S2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 1-ethyl-3-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]thiourea.
| Compound Name | 1-ethyl-3-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]thiourea |
|---|---|
| PubChem CID | 2730614 |
| Molecular Formula | C13H16N4O3S2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 1-ethyl-3-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]thiourea |
| SMILES | CCNC(=S)Nc1ccc(S(=O)(=O)Nc2cc(C)on2)cc1 |
| InChI | InChI=1S/C13H16N4O3S2/c1-3-14-13(21)15-10-4-6-11(7-5-10)22(18,19)17-12-8-9(2)20-16-12/h4-8H,3H2,1-2H3,(H,16,17)(H2,14,15,21) |
| InChIKey | CKAQRJNEMVZQPD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|