C22H23N3O7S2 — CID 166066770
dimethyl 2-[(4-methoxyphenyl)-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]methyl]propanedioate (PubChem CID 166066770) has the molecular formula C22H23N3O7S2 and a molecular weight of 505.57 g/mol. Its IUPAC name is dimethyl 2-[(4-methoxyphenyl)-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]methyl]propanedioate.
| Compound Name | dimethyl 2-[(4-methoxyphenyl)-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]methyl]propanedioate |
|---|---|
| PubChem CID | 166066770 |
| Molecular Formula | C22H23N3O7S2 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | dimethyl 2-[(4-methoxyphenyl)-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]methyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)C(Nc1ccc(S(=O)(=O)Nc2nccs2)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H23N3O7S2/c1-30-16-8-4-14(5-9-16)19(18(20(26)31-2)21(27)32-3)24-15-6-10-17(11-7-15)34(28,29)25-22-23-12-13-33-22/h4-13,18-19,24H,1-3H3,(H,23,25) |
| InChIKey | XNHNKKYSJJHXKS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 132.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|