C40H51N3O5 — CID 87628187
N-[5-[(1R)-2-[2-[4-[2-[3-[(1R)-1-[3-[di(propan-2-yl)amino]phenyl]propyl]-4-hydroxyphenyl]ethoxy]phenyl]ethylamino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide (PubChem CID 87628187) has the molecular formula C40H51N3O5 and a molecular weight of 653.86 g/mol. Its IUPAC name is N-[5-[(1R)-2-[2-[4-[2-[3-[(1R)-1-[3-[di(propan-2-yl)amino]phenyl]propyl]-4-hydroxyphenyl]ethoxy]phenyl]ethylamino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide.
| Compound Name | N-[5-[(1R)-2-[2-[4-[2-[3-[(1R)-1-[3-[di(propan-2-yl)amino]phenyl]propyl]-4-hydroxyphenyl]ethoxy]phenyl]ethylamino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide |
|---|---|
| PubChem CID | 87628187 |
| Molecular Formula | C40H51N3O5 |
| Molecular Weight | 653.86 g/mol |
| Exact Mass | 653.38 |
| IUPAC Name | N-[5-[(1R)-2-[2-[4-[2-[3-[(1R)-1-[3-[di(propan-2-yl)amino]phenyl]propyl]-4-hydroxyphenyl]ethoxy]phenyl]ethylamino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide |
| SMILES | CC[C@H](c1cccc(N(C(C)C)C(C)C)c1)c1cc(CCOc2ccc(CCNC[C@H](O)c3ccc(O)c(NC=O)c3)cc2)ccc1O |
| InChI | InChI=1S/C40H51N3O5/c1-6-35(31-8-7-9-33(23-31)43(27(2)3)28(4)5)36-22-30(12-16-38(36)45)19-21-48-34-14-10-29(11-15-34)18-20-41-25-40(47)32-13-17-39(46)37(24-32)42-26-44/h7-17,22-24,26-28,35,40-41,45-47H,6,18-21,25H2,1-5H3,(H,42,44)/t35-,40+/m1/s1 |
| InChIKey | JYVGKVLVSVIMKJ-VQOCUYOESA-N |
| XLogP | 7.32 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.86 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|