C36H48N4O4 — CID 87181574
2-[1-[9-[[2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]nonyl]pyrrolidin-3-yl]-2,2-diphenylacetamide (PubChem CID 87181574) has the molecular formula C36H48N4O4 and a molecular weight of 600.80 g/mol. Its IUPAC name is 2-[1-[9-[[2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]nonyl]pyrrolidin-3-yl]-2,2-diphenylacetamide.
| Compound Name | 2-[1-[9-[[2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]nonyl]pyrrolidin-3-yl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 87181574 |
| Molecular Formula | C36H48N4O4 |
| Molecular Weight | 600.80 g/mol |
| Exact Mass | 600.37 |
| IUPAC Name | 2-[1-[9-[[2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]nonyl]pyrrolidin-3-yl]-2,2-diphenylacetamide |
| SMILES | NC(=O)C(c1ccccc1)(c1ccccc1)C1CCN(CCCCCCCCCNCC(O)c2ccc(O)c(NC=O)c2)C1 |
| InChI | InChI=1S/C36H48N4O4/c37-35(44)36(29-14-8-6-9-15-29,30-16-10-7-11-17-30)31-20-23-40(26-31)22-13-5-3-1-2-4-12-21-38-25-34(43)28-18-19-33(42)32(24-28)39-27-41/h6-11,14-19,24,27,31,34,38,42-43H,1-5,12-13,20-23,25-26H2,(H2,37,44)(H,39,41) |
| InChIKey | FTPKXDWZDLMEJF-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.80 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|