C26H39N3O5 — CID 24764553
3-[3-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]propyl-methylamino]benzamide (PubChem CID 24764553) has the molecular formula C26H39N3O5 and a molecular weight of 473.61 g/mol. Its IUPAC name is 3-[3-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]propyl-methylamino]benzamide.
| Compound Name | 3-[3-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]propyl-methylamino]benzamide |
|---|---|
| PubChem CID | 24764553 |
| Molecular Formula | C26H39N3O5 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | 3-[3-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]propyl-methylamino]benzamide |
| SMILES | CN(CCCOCCCCCCNC[C@H](O)c1ccc(O)c(CO)c1)c1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C26H39N3O5/c1-29(23-9-6-8-21(17-23)26(27)33)13-7-15-34-14-5-3-2-4-12-28-18-25(32)20-10-11-24(31)22(16-20)19-30/h6,8-11,16-17,25,28,30-32H,2-5,7,12-15,18-19H2,1H3,(H2,27,33)/t25-/m0/s1 |
| InChIKey | ORBOKJXCZQLOJD-VWLOTQADSA-N |
| XLogP | 2.71 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|