C32H39NO5 — CID 100995988
5-[2-[benzyl-[6-(4-phenylbutoxy)hexyl]amino]acetyl]-2-hydroxy(13C)benzoic acid (PubChem CID 100995988) has the molecular formula C32H39NO5 and a molecular weight of 518.66 g/mol. Its IUPAC name is 5-[2-[benzyl-[6-(4-phenylbutoxy)hexyl]amino]acetyl]-2-hydroxy(13C)benzoic acid.
| Compound Name | 5-[2-[benzyl-[6-(4-phenylbutoxy)hexyl]amino]acetyl]-2-hydroxy(13C)benzoic acid |
|---|---|
| PubChem CID | 100995988 |
| Molecular Formula | C32H39NO5 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | 5-[2-[benzyl-[6-(4-phenylbutoxy)hexyl]amino]acetyl]-2-hydroxy(13C)benzoic acid |
| SMILES | O=C(O)c1cc([13C](=O)CN(CCCCCCOCCCCc2ccccc2)Cc2ccccc2)ccc1O |
| InChI | InChI=1S/C32H39NO5/c34-30-19-18-28(23-29(30)32(36)37)31(35)25-33(24-27-16-7-4-8-17-27)20-10-1-2-11-21-38-22-12-9-15-26-13-5-3-6-14-26/h3-8,13-14,16-19,23,34H,1-2,9-12,15,20-22,24-25H2,(H,36,37)/i31+1 |
| InChIKey | IPSBSKSPROIXPL-PNKYBBEISA-N |
| XLogP | 6.38 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|