C28H31NO4 — CID 74221914
5-[benzoyl-[(4-heptylphenyl)methyl]amino]-2-hydroxybenzoic acid (PubChem CID 74221914) has the molecular formula C28H31NO4 and a molecular weight of 445.56 g/mol. Its IUPAC name is 5-[benzoyl-[(4-heptylphenyl)methyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[benzoyl-[(4-heptylphenyl)methyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 74221914 |
| Molecular Formula | C28H31NO4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 5-[benzoyl-[(4-heptylphenyl)methyl]amino]-2-hydroxybenzoic acid |
| SMILES | CCCCCCCc1ccc(CN(C(=O)c2ccccc2)c2ccc(O)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C28H31NO4/c1-2-3-4-5-7-10-21-13-15-22(16-14-21)20-29(27(31)23-11-8-6-9-12-23)24-17-18-26(30)25(19-24)28(32)33/h6,8-9,11-19,30H,2-5,7,10,20H2,1H3,(H,32,33) |
| InChIKey | LQDGTYLTHOBMHL-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|