C27H21NO5 — CID 74221821
5-[benzyl-(4-phenoxybenzoyl)amino]-2-hydroxybenzoic acid (PubChem CID 74221821) has the molecular formula C27H21NO5 and a molecular weight of 439.47 g/mol. Its IUPAC name is 5-[benzyl-(4-phenoxybenzoyl)amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[benzyl-(4-phenoxybenzoyl)amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 74221821 |
| Molecular Formula | C27H21NO5 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 5-[benzyl-(4-phenoxybenzoyl)amino]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(N(Cc2ccccc2)C(=O)c2ccc(Oc3ccccc3)cc2)ccc1O |
| InChI | InChI=1S/C27H21NO5/c29-25-16-13-21(17-24(25)27(31)32)28(18-19-7-3-1-4-8-19)26(30)20-11-14-23(15-12-20)33-22-9-5-2-6-10-22/h1-17,29H,18H2,(H,31,32) |
| InChIKey | BGRTXENBSOHKMP-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |