C34H35NO4 — CID 144619655
N-(3-formyl-4-hydroxyphenyl)-N-[(4-heptylphenyl)methyl]-4-phenoxybenzamide (PubChem CID 144619655) has the molecular formula C34H35NO4 and a molecular weight of 521.66 g/mol. Its IUPAC name is N-(3-formyl-4-hydroxyphenyl)-N-[(4-heptylphenyl)methyl]-4-phenoxybenzamide.
| Compound Name | N-(3-formyl-4-hydroxyphenyl)-N-[(4-heptylphenyl)methyl]-4-phenoxybenzamide |
|---|---|
| PubChem CID | 144619655 |
| Molecular Formula | C34H35NO4 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.26 |
| IUPAC Name | N-(3-formyl-4-hydroxyphenyl)-N-[(4-heptylphenyl)methyl]-4-phenoxybenzamide |
| SMILES | CCCCCCCc1ccc(CN(C(=O)c2ccc(Oc3ccccc3)cc2)c2ccc(O)c(C=O)c2)cc1 |
| InChI | InChI=1S/C34H35NO4/c1-2-3-4-5-7-10-26-13-15-27(16-14-26)24-35(30-19-22-33(37)29(23-30)25-36)34(38)28-17-20-32(21-18-28)39-31-11-8-6-9-12-31/h6,8-9,11-23,25,37H,2-5,7,10,24H2,1H3 |
| InChIKey | AYDAPLZCHUEZTP-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|