C28H31NO3 — CID 144619615
N-(3-formyl-4-hydroxyphenyl)-N-[(4-heptylphenyl)methyl]benzamide (PubChem CID 144619615) has the molecular formula C28H31NO3 and a molecular weight of 429.56 g/mol. Its IUPAC name is N-(3-formyl-4-hydroxyphenyl)-N-[(4-heptylphenyl)methyl]benzamide.
| Compound Name | N-(3-formyl-4-hydroxyphenyl)-N-[(4-heptylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 144619615 |
| Molecular Formula | C28H31NO3 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | N-(3-formyl-4-hydroxyphenyl)-N-[(4-heptylphenyl)methyl]benzamide |
| SMILES | CCCCCCCc1ccc(CN(C(=O)c2ccccc2)c2ccc(O)c(C=O)c2)cc1 |
| InChI | InChI=1S/C28H31NO3/c1-2-3-4-5-7-10-22-13-15-23(16-14-22)20-29(28(32)24-11-8-6-9-12-24)26-17-18-27(31)25(19-26)21-30/h6,8-9,11-19,21,31H,2-5,7,10,20H2,1H3 |
| InChIKey | XJNARXQBKWLNKV-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|